CAS 17429-36-6 appears in our catalog under these names: 1-Methyl-2,3-dihydro-[1,1'-biphenyl]-4(1h)-one, 95%, 1–Methyl–2,3–dihydro–(1,1'–biphenyl)–4(1H)–one, 1-Methyl-2,3-dihydro-(1,1'-biphenyl)-4(1H)-one, 1-Methyl-2,3-dihydro-[1,1'-biphenyl]-4(1H)-one 95%, 1-Methyl-2,3-dihydro-[1,1'-biphenyl]-4(1H)-one, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 10g, 5g.
4-methyl-4-phenylcyclohex-2-en-1-one (CAS 17429-36-6) is a chemical compound with the molecular formula C13H14O and a molecular weight of 186.25 g/mol. IUPAC name: 4-methyl-4-phenylcyclohex-2-en-1-one. InChIKey: NTASQMWLMVNJSS-UHFFFAOYSA-N.
| Molecular formula | C13H14O |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | 4-methyl-4-phenylcyclohex-2-en-1-one |
| InChIKey | NTASQMWLMVNJSS-UHFFFAOYSA-N |
| SMILES | CC1(CCC(=O)C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)