CAS 886362-63-6 appears in our catalog under these names: [3-(4-Bromo-phenylamino)-benzyl]-carbamic acid tert-butyl ester, 95%, tert-Butyl 3-((4-bromophenyl)amino)benzylcarbamate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl N-[[3-(4-bromoanilino)phenyl]methyl]carbamate (CAS 886362-63-6) is a chemical compound with the molecular formula C18H21BrN2O2 and a molecular weight of 377.3 g/mol. IUPAC name: tert-butyl N-[[3-(4-bromoanilino)phenyl]methyl]carbamate. InChIKey: KLBUYOMJLPBLBQ-UHFFFAOYSA-N.
| Molecular formula | C18H21BrN2O2 |
|---|---|
| Molecular weight | 377.3 g/mol |
| IUPAC name | tert-butyl N-[[3-(4-bromoanilino)phenyl]methyl]carbamate |
| InChIKey | KLBUYOMJLPBLBQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC(=CC=C1)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)