CAS 886362-94-3 is the registry number for 1-(3',5'-Difluorophenyl)-2-hydroxymethyl-3-isopropylindole, 97%. Offered by: AmBeed. Available pack sizes: 5g.
[1-(3,5-difluorophenyl)-3-propan-2-ylindol-2-yl]methanol (CAS 886362-94-3) is a chemical compound with the molecular formula C18H17F2NO and a molecular weight of 301.3 g/mol. IUPAC name: [1-(3,5-difluorophenyl)-3-propan-2-ylindol-2-yl]methanol. InChIKey: DPPNYCACUIUFAY-UHFFFAOYSA-N.
| Molecular formula | C18H17F2NO |
|---|---|
| Molecular weight | 301.3 g/mol |
| IUPAC name | [1-(3,5-difluorophenyl)-3-propan-2-ylindol-2-yl]methanol |
| InChIKey | DPPNYCACUIUFAY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N(C2=CC=CC=C21)C3=CC(=CC(=C3)F)F)CO |
Computed by PubChem (NCBI)