Products 88637-37-0

CAS 88637-37-0 is the registry number for Diphenhydramine Citrate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-benzhydryloxy-N,N-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid (CAS 88637-37-0) is a chemical compound with the molecular formula C23H29NO8 and a molecular weight of 447.5 g/mol. IUPAC name: 2-benzhydryloxy-N,N-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid. InChIKey: SPCKHVPPRJWQRZ-UHFFFAOYSA-N.

Identity
Molecular formulaC23H29NO8
Molecular weight447.5 g/mol
IUPAC name2-benzhydryloxy-N,N-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid
InChIKeySPCKHVPPRJWQRZ-UHFFFAOYSA-N
SMILESCN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O

Computed by PubChem (NCBI)