Products 886496-53-3
CAS 886496-53-3 is the registry number for 5-[Ethyl-(2,2,2-trifluoro-acetyl)-amino]-naphthalene-1-sulfonyl chloride, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
5-[ethyl-(2,2,2-trifluoroacetyl)amino]naphthalene-1-sulfonyl chloride (CAS 886496-53-3) is a chemical compound with the molecular formula C14H11ClF3NO3S and a molecular weight of 365.8 g/mol. IUPAC name: 5-[ethyl-(2,2,2-trifluoroacetyl)amino]naphthalene-1-sulfonyl chloride. InChIKey: PYCHIXRGPBXXDR-UHFFFAOYSA-N.
| Molecular formula | C14H11ClF3NO3S |
|---|---|
| Molecular weight | 365.8 g/mol |
| IUPAC name | 5-[ethyl-(2,2,2-trifluoroacetyl)amino]naphthalene-1-sulfonyl chloride |
| InChIKey | PYCHIXRGPBXXDR-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=CC2=C1C=CC=C2S(=O)(=O)Cl)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)