Products 886500-71-6

CAS 886500-71-6 appears in our catalog under these names: (2,3–Difluoro–4–methoxyphenyl)methanol, 2,3-Difluoro-4-methoxybenzyl alcohol, (2,3-Difluoro-4-methoxyphenyl)methanol 97+%, 2,3-Difluoro-4-methoxybenzyl alcohol, 97%, 97%, 2,3-Difluoro-4-methoxybenzyl alcohol, 97+%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

(2,3-difluoro-4-methoxyphenyl)methanol (CAS 886500-71-6) is a chemical compound with the molecular formula C8H8F2O2 and a molecular weight of 174.14 g/mol. IUPAC name: (2,3-difluoro-4-methoxyphenyl)methanol. InChIKey: SJKZXUYOJRZFKG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8F2O2
Molecular weight174.14 g/mol
IUPAC name(2,3-difluoro-4-methoxyphenyl)methanol
InChIKeySJKZXUYOJRZFKG-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)CO)F)F

Computed by PubChem (NCBI)