CAS 886503-38-4 appears in our catalog under these names: 4-Chloro-3-(trifluoromethylthio)benzyl bromide, 95%, 4-Chloro-3-(trifluoromethylthio)benzyl bromide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
4-(bromomethyl)-1-chloro-2-(trifluoromethylsulfanyl)benzene (CAS 886503-38-4) is a chemical compound with the molecular formula C8H5BrClF3S and a molecular weight of 305.54 g/mol. IUPAC name: 4-(bromomethyl)-1-chloro-2-(trifluoromethylsulfanyl)benzene. InChIKey: QRIMMRPSWRLACM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3S |
|---|---|
| Molecular weight | 305.54 g/mol |
| IUPAC name | 4-(bromomethyl)-1-chloro-2-(trifluoromethylsulfanyl)benzene |
| InChIKey | QRIMMRPSWRLACM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)SC(F)(F)F)Cl |
Computed by PubChem (NCBI)