CAS 886504-35-4 is the registry number for 4-(3-Fluoro-4-methoxyphenyl)-2-hydrazinylthiazole, 97%. Offered by: AmBeed. Available pack sizes: 1g.
[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]hydrazine (CAS 886504-35-4) is a chemical compound with the molecular formula C10H10FN3OS and a molecular weight of 239.27 g/mol. IUPAC name: [4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]hydrazine. InChIKey: SDSJTGLYUZTZQI-UHFFFAOYSA-N.
| Molecular formula | C10H10FN3OS |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | [4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]hydrazine |
| InChIKey | SDSJTGLYUZTZQI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CSC(=N2)NN)F |
Computed by PubChem (NCBI)