Products 886536-76-1
CAS 886536-76-1 appears in our catalog under these names: NCGC00351170, NCGC00351170, 99.05%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 25 mg, 50 mg, 100 mg.
[4-(2-methoxybenzoyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]-(2-methoxyphenyl)methanone (CAS 886536-76-1) is a chemical compound with the molecular formula C18H14N2O6 and a molecular weight of 354.3 g/mol. IUPAC name: [4-(2-methoxybenzoyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]-(2-methoxyphenyl)methanone. InChIKey: CCDAHVUOLADKGY-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O6 |
|---|---|
| Molecular weight | 354.3 g/mol |
| IUPAC name | [4-(2-methoxybenzoyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]-(2-methoxyphenyl)methanone |
| InChIKey | CCDAHVUOLADKGY-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C(=O)C2=NO[N+](=C2C(=O)C3=CC=CC=C3OC)[O-] |
Computed by PubChem (NCBI)