Products 74743-22-9
CAS 74743-22-9 is the registry number for N-Phthalimido 4-Nitro-L-phenylalanine Methyl Ester. Offered by: TRC. Available pack sizes: 2,5g.
Methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoate (CAS 74743-22-9) is a chemical compound with the molecular formula C18H14N2O6 and a molecular weight of 354.3 g/mol. IUPAC name: methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoate. InChIKey: CHIVETSRXYVCAS-HNNXBMFYSA-N.
| Molecular formula | C18H14N2O6 |
|---|---|
| Molecular weight | 354.3 g/mol |
| IUPAC name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoate |
| InChIKey | CHIVETSRXYVCAS-HNNXBMFYSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)[N+](=O)[O-])N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)