CAS 88654-54-0 appears in our catalog under these names: 4-Formylbenzene-1-sulfonyl fluoride, 95%, 4-Formylbenzene-1-sulfonyl fluoride 95%, 4-Formylbenzene-1-sulfonyl fluoride, 95%, 95%, 4-Formylbenzene-1-sulfonyl fluoride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
4-formylbenzenesulfonyl fluoride (CAS 88654-54-0) is a chemical compound with the molecular formula C7H5FO3S and a molecular weight of 188.18 g/mol. IUPAC name: 4-formylbenzenesulfonyl fluoride. InChIKey: CBSXNTYILQLYSR-UHFFFAOYSA-N.
| Molecular formula | C7H5FO3S |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 4-formylbenzenesulfonyl fluoride |
| InChIKey | CBSXNTYILQLYSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)S(=O)(=O)F |
Computed by PubChem (NCBI)