CAS 886629-31-8 appears in our catalog under these names: 4-(Chloromethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole, 95%, 4-(Chloromethyl)-2-(3-(trifluoromethyl)phenyl)thiazole, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
4-(chloromethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole (CAS 886629-31-8) is a chemical compound with the molecular formula C11H7ClF3NS and a molecular weight of 277.69 g/mol. IUPAC name: 4-(chloromethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole. InChIKey: ZDYDRUGLBWIKRO-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF3NS |
|---|---|
| Molecular weight | 277.69 g/mol |
| IUPAC name | 4-(chloromethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole |
| InChIKey | ZDYDRUGLBWIKRO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NC(=CS2)CCl |
Computed by PubChem (NCBI)