CAS 886762-46-5 is the registry number for 4-[3,5-Bis(trifluoromethyl)phenyl]iodobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-(4-iodophenyl)-3,5-bis(trifluoromethyl)benzene (CAS 886762-46-5) is a chemical compound with the molecular formula C14H7F6I and a molecular weight of 416.10 g/mol. IUPAC name: 1-(4-iodophenyl)-3,5-bis(trifluoromethyl)benzene. InChIKey: XTJJSOHOYCCQGJ-UHFFFAOYSA-N.
| Molecular formula | C14H7F6I |
|---|---|
| Molecular weight | 416.10 g/mol |
| IUPAC name | 1-(4-iodophenyl)-3,5-bis(trifluoromethyl)benzene |
| InChIKey | XTJJSOHOYCCQGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)I |
Computed by PubChem (NCBI)