Products 886762-65-8

CAS 886762-65-8 is the registry number for 2-(2-Fluoro-3-methylphenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(2-fluoro-3-methylphenyl)acetic acid (CAS 886762-65-8) is a chemical compound with the molecular formula C9H9FO2 and a molecular weight of 168.16 g/mol. IUPAC name: 2-(2-fluoro-3-methylphenyl)acetic acid. InChIKey: JHILBAAZZQSBAI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FO2
Molecular weight168.16 g/mol
IUPAC name2-(2-fluoro-3-methylphenyl)acetic acid
InChIKeyJHILBAAZZQSBAI-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)CC(=O)O)F

Computed by PubChem (NCBI)