CAS 88678-17-5 is the registry number for (2-Acetyl-5-methoxyphenyl) Sulfate Sodium Salt. Offered by: TRC. Available pack sizes: 500mg.
Sodium (2-acetyl-5-methoxyphenyl) sulfate (CAS 88678-17-5) is a chemical compound with the molecular formula C9H9NaO6S and a molecular weight of 268.22 g/mol. IUPAC name: sodium (2-acetyl-5-methoxyphenyl) sulfate. InChIKey: YQXPITOIYPFUHU-UHFFFAOYSA-M.
| Molecular formula | C9H9NaO6S |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | sodium (2-acetyl-5-methoxyphenyl) sulfate |
| InChIKey | YQXPITOIYPFUHU-UHFFFAOYSA-M |
| SMILES | CC(=O)C1=C(C=C(C=C1)OC)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)