Products 886780-65-0

CAS 886780-65-0 is the registry number for 2,3-Diphenylpiperazine, 1-boc protected, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2,3-diphenylpiperazine-1-carboxylate (CAS 886780-65-0) is a chemical compound with the molecular formula C21H26N2O2 and a molecular weight of 338.4 g/mol. IUPAC name: tert-butyl 2,3-diphenylpiperazine-1-carboxylate. InChIKey: AYXUZUABTMGOKA-UHFFFAOYSA-N.

Identity
Molecular formulaC21H26N2O2
Molecular weight338.4 g/mol
IUPAC nametert-butyl 2,3-diphenylpiperazine-1-carboxylate
InChIKeyAYXUZUABTMGOKA-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCNC(C1C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)