CAS 886854-05-3 is the registry number for 2-(2-2-Dibromovinyl)-1-nitronaphthalene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
2-(2,2-dibromoethenyl)-1-nitronaphthalene (CAS 886854-05-3) is a chemical compound with the molecular formula C12H7Br2NO2 and a molecular weight of 357.00 g/mol. IUPAC name: 2-(2,2-dibromoethenyl)-1-nitronaphthalene. InChIKey: RPENJEXXZXQDBD-UHFFFAOYSA-N.
| Molecular formula | C12H7Br2NO2 |
|---|---|
| Molecular weight | 357.00 g/mol |
| IUPAC name | 2-(2,2-dibromoethenyl)-1-nitronaphthalene |
| InChIKey | RPENJEXXZXQDBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2[N+](=O)[O-])C=C(Br)Br |
Computed by PubChem (NCBI)