CAS 887-54-7 appears in our catalog under these names: 2,3,5,6-Tetrachloro-4-(methoxycarbonyl)benzoic acid, 95%, Dacthal Impurity 3, Dacthal Monoacid, >95% (HPLC), Chlorthal-monomethyl, Chlorthal-monomethyl, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, HPC Standards. Available pack sizes: on request, 10mg, 5mg, 1x10mg, 1x1ml.
2,3,5,6-tetrachloro-4-methoxycarbonylbenzoic acid (CAS 887-54-7) is a chemical compound with the molecular formula C9H4Cl4O4 and a molecular weight of 317.9 g/mol. IUPAC name: 2,3,5,6-tetrachloro-4-methoxycarbonylbenzoic acid. InChIKey: SXINVWXSZUQKSW-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl4O4 |
|---|---|
| Molecular weight | 317.9 g/mol |
| IUPAC name | 2,3,5,6-tetrachloro-4-methoxycarbonylbenzoic acid |
| InChIKey | SXINVWXSZUQKSW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C(=C1Cl)Cl)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)