CAS 88700-06-5 appears in our catalog under these names: 2,3,3',4,4',5,5'-Heptabromobiphenyl, 2,3,3',4,4',5,5'- Heptabromobiphenyl. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,4-tetrabromo-5-(3,4,5-tribromophenyl)benzene (CAS 88700-06-5) is a chemical compound with the molecular formula C12H3Br7 and a molecular weight of 706.5 g/mol. IUPAC name: 1,2,3,4-tetrabromo-5-(3,4,5-tribromophenyl)benzene. InChIKey: JXWDAVSERCQYSS-UHFFFAOYSA-N.
| Molecular formula | C12H3Br7 |
|---|---|
| Molecular weight | 706.5 g/mol |
| IUPAC name | 1,2,3,4-tetrabromo-5-(3,4,5-tribromophenyl)benzene |
| InChIKey | JXWDAVSERCQYSS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)Br)Br)C2=CC(=C(C(=C2Br)Br)Br)Br |
Computed by PubChem (NCBI)