CAS 887031-26-7 is the registry number for [2-Amino-4-(3-fluoro-4-methoxy-phenyl)-thiazol-5-yl]-acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-amino-4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-5-yl]acetic acid (CAS 887031-26-7) is a chemical compound with the molecular formula C12H11FN2O3S and a molecular weight of 282.29 g/mol. IUPAC name: 2-[2-amino-4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-5-yl]acetic acid. InChIKey: DSEQAJNJRPVJOE-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O3S |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 2-[2-amino-4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-5-yl]acetic acid |
| InChIKey | DSEQAJNJRPVJOE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(SC(=N2)N)CC(=O)O)F |
Computed by PubChem (NCBI)