CAS 887202-54-2 is the registry number for N-Hydrazinocarbonylmethyl-2-trifluoromethyl-benzamide, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
N-(2-hydrazinyl-2-oxoethyl)-2-(trifluoromethyl)benzamide (CAS 887202-54-2) is a chemical compound with the molecular formula C10H10F3N3O2 and a molecular weight of 261.20 g/mol. IUPAC name: N-(2-hydrazinyl-2-oxoethyl)-2-(trifluoromethyl)benzamide. InChIKey: WUBIJSKYXHYREU-UHFFFAOYSA-N.
| Molecular formula | C10H10F3N3O2 |
|---|---|
| Molecular weight | 261.20 g/mol |
| IUPAC name | N-(2-hydrazinyl-2-oxoethyl)-2-(trifluoromethyl)benzamide |
| InChIKey | WUBIJSKYXHYREU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCC(=O)NN)C(F)(F)F |
Computed by PubChem (NCBI)