CAS 887260-96-0 appears in our catalog under these names: Naphthalene–2,6–diyldiboronicacid, Naphthalene-2,6-diyldiboronic acid, Naphthalene-2,6-diyldiboronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 25mg, 250mg, 1g.
(6-borononaphthalen-2-yl)boronic acid (CAS 887260-96-0) is a chemical compound with the molecular formula C10H10B2O4 and a molecular weight of 215.8 g/mol. IUPAC name: (6-borononaphthalen-2-yl)boronic acid. InChIKey: LUKFOICJEVFQSR-UHFFFAOYSA-N.
| Molecular formula | C10H10B2O4 |
|---|---|
| Molecular weight | 215.8 g/mol |
| IUPAC name | (6-borononaphthalen-2-yl)boronic acid |
| InChIKey | LUKFOICJEVFQSR-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=C(C=C2)B(O)O)(O)O |
Computed by PubChem (NCBI)