CAS 887266-89-9 is the registry number for Dibromomethylpentafluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1-(dibromomethyl)-2,3,4,5,6-pentafluorobenzene (CAS 887266-89-9) is a chemical compound with the molecular formula C7HBr2F5 and a molecular weight of 339.88 g/mol. IUPAC name: 1-(dibromomethyl)-2,3,4,5,6-pentafluorobenzene. InChIKey: SCGYCYOVWSMRBB-UHFFFAOYSA-N.
| Molecular formula | C7HBr2F5 |
|---|---|
| Molecular weight | 339.88 g/mol |
| IUPAC name | 1-(dibromomethyl)-2,3,4,5,6-pentafluorobenzene |
| InChIKey | SCGYCYOVWSMRBB-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C(Br)Br |
Computed by PubChem (NCBI)