CAS 887336-06-3 appears in our catalog under these names: (S)-1-(Adamantan-1-yl)ethan-1-amine, 98%, (1S)-1-(Adamantan-1-yl)ethan-1-amine. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1g, 100mg.
(1S)-1-(1-adamantyl)ethanamine (CAS 887336-06-3) is a chemical compound with the molecular formula C12H21N and a molecular weight of 179.30 g/mol. IUPAC name: (1S)-1-(1-adamantyl)ethanamine. InChIKey: UBCHPRBFMUDMNC-JKJWBTBISA-N.
| Molecular formula | C12H21N |
|---|---|
| Molecular weight | 179.30 g/mol |
| IUPAC name | (1S)-1-(1-adamantyl)ethanamine |
| InChIKey | UBCHPRBFMUDMNC-JKJWBTBISA-N |
| SMILES | C[C@@H](C12CC3CC(C1)CC(C3)C2)N |
Computed by PubChem (NCBI)