CAS 887343-51-3 is the registry number for 6-Benzyloxy-2-bromo-5-chloronaphthalene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
6-bromo-1-chloro-2-phenylmethoxynaphthalene (CAS 887343-51-3) is a chemical compound with the molecular formula C17H12BrClO and a molecular weight of 347.6 g/mol. IUPAC name: 6-bromo-1-chloro-2-phenylmethoxynaphthalene. InChIKey: OPWJSCZEMUVBLT-UHFFFAOYSA-N.
| Molecular formula | C17H12BrClO |
|---|---|
| Molecular weight | 347.6 g/mol |
| IUPAC name | 6-bromo-1-chloro-2-phenylmethoxynaphthalene |
| InChIKey | OPWJSCZEMUVBLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C3=C(C=C2)C=C(C=C3)Br)Cl |
Computed by PubChem (NCBI)