Products 887350-78-9
CAS 887350-78-9 is the registry number for 4,7-Dichloro-8-methyl-2-(trifluoromethyl)quinoline, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 1g, 5g.
4,7-dichloro-8-methyl-2-(trifluoromethyl)quinoline (CAS 887350-78-9) is a chemical compound with the molecular formula C11H6Cl2F3N and a molecular weight of 280.07 g/mol. IUPAC name: 4,7-dichloro-8-methyl-2-(trifluoromethyl)quinoline. InChIKey: KCBAMMZWGCMDMX-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2F3N |
|---|---|
| Molecular weight | 280.07 g/mol |
| IUPAC name | 4,7-dichloro-8-methyl-2-(trifluoromethyl)quinoline |
| InChIKey | KCBAMMZWGCMDMX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1N=C(C=C2Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)