CAS 259175-24-1 is the registry number for 1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-1h-pyrrole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrrole (CAS 259175-24-1) is a chemical compound with the molecular formula C11H6Cl2F3N and a molecular weight of 280.07 g/mol. IUPAC name: 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrrole. InChIKey: DQNDNYMRQWSEJV-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2F3N |
|---|---|
| Molecular weight | 280.07 g/mol |
| IUPAC name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrrole |
| InChIKey | DQNDNYMRQWSEJV-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=C(C=C(C=C2Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)