CAS 887352-65-0 appears in our catalog under these names: Benzophenone-4-carboxamidoethyl methanethiosulfonate, 98%, Benzophenone-4-carboxamidoethyl Methanethiosulfonate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
4-benzoyl-N-(2-methylsulfonylsulfanylethyl)benzamide (CAS 887352-65-0) is a chemical compound with the molecular formula C17H17NO4S2 and a molecular weight of 363.5 g/mol. IUPAC name: 4-benzoyl-N-(2-methylsulfonylsulfanylethyl)benzamide. InChIKey: YIUXLJAIGUUOOX-UHFFFAOYSA-N.
| Molecular formula | C17H17NO4S2 |
|---|---|
| Molecular weight | 363.5 g/mol |
| IUPAC name | 4-benzoyl-N-(2-methylsulfonylsulfanylethyl)benzamide |
| InChIKey | YIUXLJAIGUUOOX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)SCCNC(=O)C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)