CAS 887353-18-6 is the registry number for Diallyl (9-oxo-9,10-dihydroacridine-3,6-diyl)dicarbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Prop-2-enyl N-[9-oxo-6-(prop-2-enoxycarbonylamino)-10H-acridin-3-yl]carbamate (CAS 887353-18-6) is a chemical compound with the molecular formula C21H19N3O5 and a molecular weight of 393.4 g/mol. IUPAC name: prop-2-enyl N-[9-oxo-6-(prop-2-enoxycarbonylamino)-10H-acridin-3-yl]carbamate. InChIKey: HPEVEHIOZFNEGW-UHFFFAOYSA-N.
| Molecular formula | C21H19N3O5 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | prop-2-enyl N-[9-oxo-6-(prop-2-enoxycarbonylamino)-10H-acridin-3-yl]carbamate |
| InChIKey | HPEVEHIOZFNEGW-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)NC1=CC2=C(C=C1)C(=O)C3=C(N2)C=C(C=C3)NC(=O)OCC=C |
Computed by PubChem (NCBI)