CAS 887354-46-3 is the registry number for 9,10-Dichloro-2,6-dimethylanthracene. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
9,10-dichloro-2,6-dimethylanthracene (CAS 887354-46-3) is a chemical compound with the molecular formula C16H12Cl2 and a molecular weight of 275.2 g/mol. IUPAC name: 9,10-dichloro-2,6-dimethylanthracene. InChIKey: MSPFHAUJGCSBSJ-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2 |
|---|---|
| Molecular weight | 275.2 g/mol |
| IUPAC name | 9,10-dichloro-2,6-dimethylanthracene |
| InChIKey | MSPFHAUJGCSBSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=C3C=C(C=CC3=C2Cl)C)Cl |
Computed by PubChem (NCBI)