CAS 887399-47-5 appears in our catalog under these names: 4-((4-Ethylpiperazin-1-yl)methyl)-3-(trifluoromethyl)benzoic acid hydrochloride, 95%, 4–((4–Ethylpiperazin–1–yl)methyl)–3–(trifluoromethyl)benzoic acid hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 100mg, 1g.
4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)benzoic acid;hydrochloride (CAS 887399-47-5) is a chemical compound with the molecular formula C15H20ClF3N2O2 and a molecular weight of 352.78 g/mol. IUPAC name: 4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)benzoic acid;hydrochloride. InChIKey: QBQGEIMVQREGSM-UHFFFAOYSA-N.
| Molecular formula | C15H20ClF3N2O2 |
|---|---|
| Molecular weight | 352.78 g/mol |
| IUPAC name | 4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)benzoic acid;hydrochloride |
| InChIKey | QBQGEIMVQREGSM-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)CC2=C(C=C(C=C2)C(=O)O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)