CAS 887406-47-5 is the registry number for 4-(Hydroxymethyl)benzyl Methanethiosulfonate. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
[4-(methylsulfonylsulfanylmethyl)phenyl]methanol (CAS 887406-47-5) is a chemical compound with the molecular formula C9H12O3S2 and a molecular weight of 232.3 g/mol. IUPAC name: [4-(methylsulfonylsulfanylmethyl)phenyl]methanol. InChIKey: GMXLIEXWALUYMT-UHFFFAOYSA-N.
| Molecular formula | C9H12O3S2 |
|---|---|
| Molecular weight | 232.3 g/mol |
| IUPAC name | [4-(methylsulfonylsulfanylmethyl)phenyl]methanol |
| InChIKey | GMXLIEXWALUYMT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)SCC1=CC=C(C=C1)CO |
Computed by PubChem (NCBI)