CAS 887407-04-7 is the registry number for 3,3'-Dimethyl-[2,2'-bithiophene]-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-5-(3-methylthiophen-2-yl)thiophene-2-carbaldehyde (CAS 887407-04-7) is a chemical compound with the molecular formula C11H10OS2 and a molecular weight of 222.3 g/mol. IUPAC name: 4-methyl-5-(3-methylthiophen-2-yl)thiophene-2-carbaldehyde. InChIKey: DDZAAXVYZHTAHO-UHFFFAOYSA-N.
| Molecular formula | C11H10OS2 |
|---|---|
| Molecular weight | 222.3 g/mol |
| IUPAC name | 4-methyl-5-(3-methylthiophen-2-yl)thiophene-2-carbaldehyde |
| InChIKey | DDZAAXVYZHTAHO-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)C2=C(C=C(S2)C=O)C |
Computed by PubChem (NCBI)