CAS 88744-04-1 appears in our catalog under these names: (9H–Fluoren–9–yl)methyl (perfluorophenyl) carbonate, 9-Fluorenylmethyl Pentafluorophenyl Carbonate, >98.0%(HPLC), Fmoc-OPfp 97%, Carbonic acid, 9H-fluoren-9-ylmethyl 2,3,4,5,6-pentafluorophenyl ester, 97%, 97%, (9H-Fluoren-9-yl)methyl (perfluorophenyl) carbonate, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100g, 250mg.
9H-fluoren-9-ylmethyl (2,3,4,5,6-pentafluorophenyl) carbonate (CAS 88744-04-1) is a chemical compound with the molecular formula C21H11F5O3 and a molecular weight of 406.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl (2,3,4,5,6-pentafluorophenyl) carbonate. InChIKey: CBBKZVZOEBSFQX-UHFFFAOYSA-N.
| Molecular formula | C21H11F5O3 |
|---|---|
| Molecular weight | 406.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl (2,3,4,5,6-pentafluorophenyl) carbonate |
| InChIKey | CBBKZVZOEBSFQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)OC4=C(C(=C(C(=C4F)F)F)F)F |
Computed by PubChem (NCBI)