Products 887569-76-8

CAS 887569-76-8 is the registry number for 4-Methylene-5-oxo-4,5-dihydrofuran-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-methylidene-5-oxofuran-3-carboxylic acid (CAS 887569-76-8) is a chemical compound with the molecular formula C6H4O4 and a molecular weight of 140.09 g/mol. IUPAC name: 4-methylidene-5-oxofuran-3-carboxylic acid. InChIKey: QLSLBFIEERRVOD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4O4
Molecular weight140.09 g/mol
IUPAC name4-methylidene-5-oxofuran-3-carboxylic acid
InChIKeyQLSLBFIEERRVOD-UHFFFAOYSA-N
SMILESC=C1C(=COC1=O)C(=O)O

Computed by PubChem (NCBI)