Products 887585-86-6

CAS 887585-86-6 is the registry number for 4-Bromo-3-(methylthio)thiophene-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-bromo-3-methylsulfanylthiophene-2-carboxylic acid (CAS 887585-86-6) is a chemical compound with the molecular formula C6H5BrO2S2 and a molecular weight of 253.1 g/mol. IUPAC name: 4-bromo-3-methylsulfanylthiophene-2-carboxylic acid. InChIKey: INYJZTRTDQGDKM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BrO2S2
Molecular weight253.1 g/mol
IUPAC name4-bromo-3-methylsulfanylthiophene-2-carboxylic acid
InChIKeyINYJZTRTDQGDKM-UHFFFAOYSA-N
SMILESCSC1=C(SC=C1Br)C(=O)O

Computed by PubChem (NCBI)