CAS 887588-15-0 appears in our catalog under these names: 2-(Chloromethyl)-5-nitropyridine, 95%, 2-(Chloromethyl)-5-nitropyridine 95+%, 2-(Chloromethyl)-5-nitropyridine, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-(chloromethyl)-5-nitropyridine (CAS 887588-15-0) is a chemical compound with the molecular formula C6H5ClN2O2 and a molecular weight of 172.57 g/mol. IUPAC name: 2-(chloromethyl)-5-nitropyridine. InChIKey: SHXLNXXMMVOIAO-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O2 |
|---|---|
| Molecular weight | 172.57 g/mol |
| IUPAC name | 2-(chloromethyl)-5-nitropyridine |
| InChIKey | SHXLNXXMMVOIAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1[N+](=O)[O-])CCl |
Computed by PubChem (NCBI)