CAS 887628-40-2 appears in our catalog under these names: Slc-nhs-(+)-biotin, 95%, Biotin–C10–NHS Ester, SLc-nhs-(+)-biotin, 95%, 95%, Biotin-C10-NHS Ester, 99.49%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 10 mg, 50 mg, 5 mg, 100 mg, 25 mg.
(2,5-dioxopyrrolidin-1-yl) 11-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]undecanoate (CAS 887628-40-2) is a chemical compound with the molecular formula C25H40N4O6S and a molecular weight of 524.7 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 11-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]undecanoate. InChIKey: GLPJBFGUGLWLPE-JXQFQVJHSA-N.
| Molecular formula | C25H40N4O6S |
|---|---|
| Molecular weight | 524.7 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 11-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]undecanoate |
| InChIKey | GLPJBFGUGLWLPE-JXQFQVJHSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCCCCCCCNC(=O)CCCC[C@H]2[C@@H]3[C@H](CS2)NC(=O)N3 |
Computed by PubChem (NCBI)