CAS 887644-98-6 is the registry number for (7-Methoxy-3-oxo-1,3-dihydroisobenzofuran-1-yl)triphenylphosphonium bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(7-methoxy-3-oxo-1H-2-benzofuran-1-yl)-triphenylphosphanium bromide (CAS 887644-98-6) is a chemical compound with the molecular formula C27H22BrO3P and a molecular weight of 505.3 g/mol. IUPAC name: (7-methoxy-3-oxo-1H-2-benzofuran-1-yl)-triphenylphosphanium bromide. InChIKey: CLUSSCIAHXNCTA-UHFFFAOYSA-M.
| Molecular formula | C27H22BrO3P |
|---|---|
| Molecular weight | 505.3 g/mol |
| IUPAC name | (7-methoxy-3-oxo-1H-2-benzofuran-1-yl)-triphenylphosphanium bromide |
| InChIKey | CLUSSCIAHXNCTA-UHFFFAOYSA-M |
| SMILES | COC1=CC=CC2=C1C(OC2=O)[P+](C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5.[Br-] |
Computed by PubChem (NCBI)