CAS 887703-89-1 is the registry number for Rosuvastatin Impurity 91. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-6-(triphenyl-lambda5-phosphanylidene)hexanoate (CAS 887703-89-1) is a chemical compound with the molecular formula C31H39O4PSi and a molecular weight of 534.7 g/mol. IUPAC name: methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-6-(triphenyl-lambda5-phosphanylidene)hexanoate. InChIKey: LKFANOWXMJEZDI-UHFFFAOYSA-N.
| Molecular formula | C31H39O4PSi |
|---|---|
| Molecular weight | 534.7 g/mol |
| IUPAC name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-6-(triphenyl-lambda5-phosphanylidene)hexanoate |
| InChIKey | LKFANOWXMJEZDI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC(CC(=O)C=P(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)CC(=O)OC |
Computed by PubChem (NCBI)