Products 887922-05-6
CAS 887922-05-6 is the registry number for (S)-2-Chloro-5,6,7,8-tetrahydroquinolin-8-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(8S)-2-chloro-5,6,7,8-tetrahydroquinolin-8-ol (CAS 887922-05-6) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: (8S)-2-chloro-5,6,7,8-tetrahydroquinolin-8-ol. InChIKey: IAJNDQUFQBHDAH-ZETCQYMHSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | (8S)-2-chloro-5,6,7,8-tetrahydroquinolin-8-ol |
| InChIKey | IAJNDQUFQBHDAH-ZETCQYMHSA-N |
| SMILES | C1C[C@@H](C2=C(C1)C=CC(=N2)Cl)O |
Computed by PubChem (NCBI)