CAS 888041-37-0 appears in our catalog under these names: 2,7-Dibromotriphenylene, 95%, 2,7-Dibromotriphenylene, >98.0%(GC), 2,7-Dibromotriphenylene 97%, 2,7-Dibromotriphenylene, 97%, 97%, 2,7-Dibromotriphenylene, 97%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 200mg, 25g, 100mg, 250mg.
2,7-dibromotriphenylene (CAS 888041-37-0) is a chemical compound with the molecular formula C18H10Br2 and a molecular weight of 386.1 g/mol. IUPAC name: 2,7-dibromotriphenylene. InChIKey: BPGPBYGXGRDFQG-UHFFFAOYSA-N.
| Molecular formula | C18H10Br2 |
|---|---|
| Molecular weight | 386.1 g/mol |
| IUPAC name | 2,7-dibromotriphenylene |
| InChIKey | BPGPBYGXGRDFQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC(=C3)Br)C4=C2C=C(C=C4)Br |
Computed by PubChem (NCBI)