CAS 888103-33-1 appears in our catalog under these names: 5-Oxo-5-{4-(4-(propan-2-yl)benzenesulfonyl)piperazin-1-yl}pentanoic acid, 95%, 5-Oxo-5-{4-(4-(propan-2-yl)benzenesulfonyl)piperazin-1-yl}pentanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-oxo-5-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]pentanoic acid (CAS 888103-33-1) is a chemical compound with the molecular formula C18H26N2O5S and a molecular weight of 382.5 g/mol. IUPAC name: 5-oxo-5-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]pentanoic acid. InChIKey: TVPMERSPBURHAT-UHFFFAOYSA-N.
| Molecular formula | C18H26N2O5S |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 5-oxo-5-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]pentanoic acid |
| InChIKey | TVPMERSPBURHAT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)C(=O)CCCC(=O)O |
Computed by PubChem (NCBI)