CAS 888323-67-9 is the registry number for 1-(tert-Butyl) 2-methyl (2S,4R)-4-(tert-butylthio)pyrrolidine-1,2-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-O-tert-butyl 2-O-methyl (2S,4R)-4-tert-butylsulfanylpyrrolidine-1,2-dicarboxylate (CAS 888323-67-9) is a chemical compound with the molecular formula C15H27NO4S and a molecular weight of 317.4 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R)-4-tert-butylsulfanylpyrrolidine-1,2-dicarboxylate. InChIKey: WCYQVEOAMIMQPQ-MNOVXSKESA-N.
| Molecular formula | C15H27NO4S |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-tert-butylsulfanylpyrrolidine-1,2-dicarboxylate |
| InChIKey | WCYQVEOAMIMQPQ-MNOVXSKESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)OC)SC(C)(C)C |
Computed by PubChem (NCBI)