Products 888324-28-5
CAS 888324-28-5 is the registry number for 2,6-Diisopropyl-4-(trifluoromethyl)aniline, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-di(propan-2-yl)-4-(trifluoromethyl)aniline (CAS 888324-28-5) is a chemical compound with the molecular formula C13H18F3N and a molecular weight of 245.28 g/mol. IUPAC name: 2,6-di(propan-2-yl)-4-(trifluoromethyl)aniline. InChIKey: RTIQAHIUBBTKFY-UHFFFAOYSA-N.
| Molecular formula | C13H18F3N |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | 2,6-di(propan-2-yl)-4-(trifluoromethyl)aniline |
| InChIKey | RTIQAHIUBBTKFY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1N)C(C)C)C(F)(F)F |
Computed by PubChem (NCBI)