CAS 888327-74-0 is the registry number for 2-Hydroxy nile red (trifluoromethanesulfonate). Offered by: MedChemExpress. Available pack sizes: Get quote.
9-(diethylamino)-5-hydroxybenzo[a]phenoxazin-2-one;trifluoromethanesulfonic acid (CAS 888327-74-0) is a chemical compound with the molecular formula C21H19F3N2O6S and a molecular weight of 484.4 g/mol. IUPAC name: 9-(diethylamino)-5-hydroxybenzo[a]phenoxazin-2-one;trifluoromethanesulfonic acid. InChIKey: PUIUFNSTLSJGOE-UHFFFAOYSA-N.
| Molecular formula | C21H19F3N2O6S |
|---|---|
| Molecular weight | 484.4 g/mol |
| IUPAC name | 9-(diethylamino)-5-hydroxybenzo[a]phenoxazin-2-one;trifluoromethanesulfonic acid |
| InChIKey | PUIUFNSTLSJGOE-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC(=O)C=CC4=C(C=C3O2)O.C(F)(F)(F)S(=O)(=O)O |
Computed by PubChem (NCBI)