CAS 888711-49-7 is the registry number for Potassium trifluoro(thiophen-2-ylmethyl)borate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Potassium trifluoro(thiophen-2-ylmethyl)boranuide (CAS 888711-49-7) is a chemical compound with the molecular formula C5H5BF3KS and a molecular weight of 204.07 g/mol. IUPAC name: potassium trifluoro(thiophen-2-ylmethyl)boranuide. InChIKey: ZQXVXPIJXQWYQG-UHFFFAOYSA-N.
| Molecular formula | C5H5BF3KS |
|---|---|
| Molecular weight | 204.07 g/mol |
| IUPAC name | potassium trifluoro(thiophen-2-ylmethyl)boranuide |
| InChIKey | ZQXVXPIJXQWYQG-UHFFFAOYSA-N |
| SMILES | [B-](CC1=CC=CS1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)