CAS 888724-51-4 appears in our catalog under these names: 2-Hydroxyethyl-trimethylammonium l-(+)-lactate, 95%, 2-HYDROXYETHYL-TRIMETHYLAMMONIUM L-(+)-, 2-Hydroxyethyl-trimethylammonium L-(+)-lactate, 75%, 75%. Offered by: Combi-blocks, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 50g, 1g.
2-hydroxyethyl(trimethyl)azanium;(2S)-2-hydroxypropanoate (CAS 888724-51-4) is a chemical compound with the molecular formula C8H19NO4 and a molecular weight of 193.24 g/mol. IUPAC name: 2-hydroxyethyl(trimethyl)azanium;(2S)-2-hydroxypropanoate. InChIKey: MIFGTXFTLQVWJW-WNQIDUERSA-M.
| Molecular formula | C8H19NO4 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 2-hydroxyethyl(trimethyl)azanium;(2S)-2-hydroxypropanoate |
| InChIKey | MIFGTXFTLQVWJW-WNQIDUERSA-M |
| SMILES | C[C@@H](C(=O)[O-])O.C[N+](C)(C)CCO |
Computed by PubChem (NCBI)