CAS 88874-11-7 is the registry number for Acetylated Flupirtine. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]acetamide (CAS 88874-11-7) is a chemical compound with the molecular formula C14H15FN4O and a molecular weight of 274.29 g/mol. IUPAC name: N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]acetamide. InChIKey: DRLYXYQWBLIUFS-UHFFFAOYSA-N.
| Molecular formula | C14H15FN4O |
|---|---|
| Molecular weight | 274.29 g/mol |
| IUPAC name | N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]acetamide |
| InChIKey | DRLYXYQWBLIUFS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(N=C(C=C1)NCC2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)