Products 888970-80-7

CAS 888970-80-7 is the registry number for 3-Fluorocyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-fluorocyclohexane-1-carboxylic acid (CAS 888970-80-7) is a chemical compound with the molecular formula C7H11FO2 and a molecular weight of 146.16 g/mol. IUPAC name: 3-fluorocyclohexane-1-carboxylic acid. InChIKey: CMCQHTSLVRCTPC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11FO2
Molecular weight146.16 g/mol
IUPAC name3-fluorocyclohexane-1-carboxylic acid
InChIKeyCMCQHTSLVRCTPC-UHFFFAOYSA-N
SMILESC1CC(CC(C1)F)C(=O)O

Computed by PubChem (NCBI)